C13H12N2O2S3 — CID 16934138
N-(4,7-dimethyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide (PubChem CID 16934138) has the molecular formula C13H12N2O2S3 and a molecular weight of 324.45 g/mol. Its IUPAC name is N-(4,7-dimethyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide.
| Compound Name | N-(4,7-dimethyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 16934138 |
| Molecular Formula | C13H12N2O2S3 |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | N-(4,7-dimethyl-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide |
| SMILES | Cc1ccc(C)c2sc(NS(=O)(=O)c3cccs3)nc12 |
| InChI | InChI=1S/C13H12N2O2S3/c1-8-5-6-9(2)12-11(8)14-13(19-12)15-20(16,17)10-4-3-7-18-10/h3-7H,1-2H3,(H,14,15) |
| InChIKey | CUNYEMONRGQCEP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |