C11H6Cl2N2O2S3 — CID 16934134
N-(4,5-dichloro-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide (PubChem CID 16934134) has the molecular formula C11H6Cl2N2O2S3 and a molecular weight of 365.29 g/mol. Its IUPAC name is N-(4,5-dichloro-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide.
| Compound Name | N-(4,5-dichloro-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 16934134 |
| Molecular Formula | C11H6Cl2N2O2S3 |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 363.90 |
| IUPAC Name | N-(4,5-dichloro-1,3-benzothiazol-2-yl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1nc2c(Cl)c(Cl)ccc2s1)c1cccs1 |
| InChI | InChI=1S/C11H6Cl2N2O2S3/c12-6-3-4-7-10(9(6)13)14-11(19-7)15-20(16,17)8-2-1-5-18-8/h1-5H,(H,14,15) |
| InChIKey | MCXNRNFXBYURDZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |