C14H11ClN2O3S2 — CID 16934023
N-(4-chloro-1,3-benzothiazol-2-yl)-4-methoxybenzenesulfonamide (PubChem CID 16934023) has the molecular formula C14H11ClN2O3S2 and a molecular weight of 354.84 g/mol. Its IUPAC name is N-(4-chloro-1,3-benzothiazol-2-yl)-4-methoxybenzenesulfonamide.
| Compound Name | N-(4-chloro-1,3-benzothiazol-2-yl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 16934023 |
| Molecular Formula | C14H11ClN2O3S2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | N-(4-chloro-1,3-benzothiazol-2-yl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2nc3c(Cl)cccc3s2)cc1 |
| InChI | InChI=1S/C14H11ClN2O3S2/c1-20-9-5-7-10(8-6-9)22(18,19)17-14-16-13-11(15)3-2-4-12(13)21-14/h2-8H,1H3,(H,16,17) |
| InChIKey | ZASNLRNFUNRGKJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |