C14H12N2O3S2 — CID 670284
N-(6-methoxy-1,3-benzothiazol-2-yl)benzenesulfonamide (PubChem CID 670284) has the molecular formula C14H12N2O3S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)benzenesulfonamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 670284 |
| Molecular Formula | C14H12N2O3S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)benzenesulfonamide |
| SMILES | COc1ccc2nc(NS(=O)(=O)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C14H12N2O3S2/c1-19-10-7-8-12-13(9-10)20-14(15-12)16-21(17,18)11-5-3-2-4-6-11/h2-9H,1H3,(H,15,16) |
| InChIKey | WNSZWEWTCZYWFU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |