C17H16N2O4S2 — CID 6484634
3-(benzenesulfonyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)propanamide (PubChem CID 6484634) has the molecular formula C17H16N2O4S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 6484634 |
| Molecular Formula | C17H16N2O4S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(6-methoxy-1,3-benzothiazol-2-yl)propanamide |
| SMILES | COc1ccc2nc(NC(=O)CCS(=O)(=O)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C17H16N2O4S2/c1-23-12-7-8-14-15(11-12)24-17(18-14)19-16(20)9-10-25(21,22)13-5-3-2-4-6-13/h2-8,11H,9-10H2,1H3,(H,18,19,20) |
| InChIKey | COTXUXFIDSEDNR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |