C17H16FN3O4S2 — CID 7600479
3-(4-fluorophenyl)sulfonyl-N'-(6-methoxy-1,3-benzothiazol-2-yl)propanehydrazide (PubChem CID 7600479) has the molecular formula C17H16FN3O4S2 and a molecular weight of 409.46 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfonyl-N'-(6-methoxy-1,3-benzothiazol-2-yl)propanehydrazide.
| Compound Name | 3-(4-fluorophenyl)sulfonyl-N'-(6-methoxy-1,3-benzothiazol-2-yl)propanehydrazide |
|---|---|
| PubChem CID | 7600479 |
| Molecular Formula | C17H16FN3O4S2 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 3-(4-fluorophenyl)sulfonyl-N'-(6-methoxy-1,3-benzothiazol-2-yl)propanehydrazide |
| SMILES | COc1ccc2nc(NNC(=O)CCS(=O)(=O)c3ccc(F)cc3)sc2c1 |
| InChI | InChI=1S/C17H16FN3O4S2/c1-25-12-4-7-14-15(10-12)26-17(19-14)21-20-16(22)8-9-27(23,24)13-5-2-11(18)3-6-13/h2-7,10H,8-9H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | IWTYMPAORBAIRY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|