C17H15N3O6S2 — CID 41323629
3-(4-methoxyphenyl)sulfonyl-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide (PubChem CID 41323629) has the molecular formula C17H15N3O6S2 and a molecular weight of 421.46 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)sulfonyl-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 3-(4-methoxyphenyl)sulfonyl-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 41323629 |
| Molecular Formula | C17H15N3O6S2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 3-(4-methoxyphenyl)sulfonyl-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide |
| SMILES | COc1ccc(S(=O)(=O)CCC(=O)Nc2nc3ccc([N+](=O)[O-])cc3s2)cc1 |
| InChI | InChI=1S/C17H15N3O6S2/c1-26-12-3-5-13(6-4-12)28(24,25)9-8-16(21)19-17-18-14-7-2-11(20(22)23)10-15(14)27-17/h2-7,10H,8-9H2,1H3,(H,18,19,21) |
| InChIKey | JYSYMZWQWHEGNP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 128.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|