C15H10N4O5S — CID 3636961
N-(6-nitro-1,3-benzothiazol-2-yl)-2-(4-nitrophenyl)acetamide (PubChem CID 3636961) has the molecular formula C15H10N4O5S and a molecular weight of 358.34 g/mol. Its IUPAC name is N-(6-nitro-1,3-benzothiazol-2-yl)-2-(4-nitrophenyl)acetamide.
| Compound Name | N-(6-nitro-1,3-benzothiazol-2-yl)-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3636961 |
| Molecular Formula | C15H10N4O5S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | N-(6-nitro-1,3-benzothiazol-2-yl)-2-(4-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C15H10N4O5S/c20-14(7-9-1-3-10(4-2-9)18(21)22)17-15-16-12-6-5-11(19(23)24)8-13(12)25-15/h1-6,8H,7H2,(H,16,17,20) |
| InChIKey | QQKHIFXIVZMKCH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|