C11H12N4O4S — CID 58681279
1-[(2R)-2-hydroxypropyl]-3-(6-nitro-1,3-benzothiazol-2-yl)urea (PubChem CID 58681279) has the molecular formula C11H12N4O4S and a molecular weight of 296.31 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxypropyl]-3-(6-nitro-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-[(2R)-2-hydroxypropyl]-3-(6-nitro-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 58681279 |
| Molecular Formula | C11H12N4O4S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 1-[(2R)-2-hydroxypropyl]-3-(6-nitro-1,3-benzothiazol-2-yl)urea |
| SMILES | C[C@@H](O)CNC(=O)Nc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C11H12N4O4S/c1-6(16)5-12-10(17)14-11-13-8-3-2-7(15(18)19)4-9(8)20-11/h2-4,6,16H,5H2,1H3,(H2,12,13,14,17)/t6-/m1/s1 |
| InChIKey | IAINCLVLDJKNDB-ZCFIWIBFSA-N |
| XLogP | 1.71 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|