C11H13N5O3S — CID 23549201
1-(3-aminopropyl)-3-(6-nitro-1,3-benzothiazol-2-yl)urea (PubChem CID 23549201) has the molecular formula C11H13N5O3S and a molecular weight of 295.32 g/mol. Its IUPAC name is 1-(3-aminopropyl)-3-(6-nitro-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-(3-aminopropyl)-3-(6-nitro-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 23549201 |
| Molecular Formula | C11H13N5O3S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 1-(3-aminopropyl)-3-(6-nitro-1,3-benzothiazol-2-yl)urea |
| SMILES | NCCCNC(=O)Nc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C11H13N5O3S/c12-4-1-5-13-10(17)15-11-14-8-3-2-7(16(18)19)6-9(8)20-11/h2-3,6H,1,4-5,12H2,(H2,13,14,15,17) |
| InChIKey | WCMZKVPKLZHBOZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|