C16H25ClN5O3S+ — CID 159182840
diethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)carbamoylamino]butyl]azanium;hydrochloride (PubChem CID 159182840) has the molecular formula C16H25ClN5O3S+ and a molecular weight of 402.93 g/mol. Its IUPAC name is diethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)carbamoylamino]butyl]azanium;hydrochloride.
| Compound Name | diethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)carbamoylamino]butyl]azanium;hydrochloride |
|---|---|
| PubChem CID | 159182840 |
| Molecular Formula | C16H25ClN5O3S+ |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | diethyl-[4-[(6-nitro-1,3-benzothiazol-2-yl)carbamoylamino]butyl]azanium;hydrochloride |
| SMILES | CC[NH+](CC)CCCCNC(=O)Nc1nc2ccc([N+](=O)[O-])cc2s1.Cl |
| InChI | InChI=1S/C16H23N5O3S.ClH/c1-3-20(4-2)10-6-5-9-17-15(22)19-16-18-13-8-7-12(21(23)24)11-14(13)25-16;/h7-8,11H,3-6,9-10H2,1-2H3,(H2,17,18,19,22);1H/p+1 |
| InChIKey | MTHFDERHQFTLHI-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|