C14H7BrClN3O3S — CID 4506378
2-bromo-N-(6-chloro-1,3-benzothiazol-2-yl)-5-nitrobenzamide (PubChem CID 4506378) has the molecular formula C14H7BrClN3O3S and a molecular weight of 412.65 g/mol. Its IUPAC name is 2-bromo-N-(6-chloro-1,3-benzothiazol-2-yl)-5-nitrobenzamide.
| Compound Name | 2-bromo-N-(6-chloro-1,3-benzothiazol-2-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 4506378 |
| Molecular Formula | C14H7BrClN3O3S |
| Molecular Weight | 412.65 g/mol |
| Exact Mass | 410.91 |
| IUPAC Name | 2-bromo-N-(6-chloro-1,3-benzothiazol-2-yl)-5-nitrobenzamide |
| SMILES | O=C(Nc1nc2ccc(Cl)cc2s1)c1cc([N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C14H7BrClN3O3S/c15-10-3-2-8(19(21)22)6-9(10)13(20)18-14-17-11-4-1-7(16)5-12(11)23-14/h1-6H,(H,17,18,20) |
| InChIKey | AACBEYOHBLMXEE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|