C18H16ClN3O4S — CID 19211081
N-(6-butoxy-1,3-benzothiazol-2-yl)-2-chloro-4-nitrobenzamide (PubChem CID 19211081) has the molecular formula C18H16ClN3O4S and a molecular weight of 405.86 g/mol. Its IUPAC name is N-(6-butoxy-1,3-benzothiazol-2-yl)-2-chloro-4-nitrobenzamide.
| Compound Name | N-(6-butoxy-1,3-benzothiazol-2-yl)-2-chloro-4-nitrobenzamide |
|---|---|
| PubChem CID | 19211081 |
| Molecular Formula | C18H16ClN3O4S |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | N-(6-butoxy-1,3-benzothiazol-2-yl)-2-chloro-4-nitrobenzamide |
| SMILES | CCCCOc1ccc2nc(NC(=O)c3ccc([N+](=O)[O-])cc3Cl)sc2c1 |
| InChI | InChI=1S/C18H16ClN3O4S/c1-2-3-8-26-12-5-7-15-16(10-12)27-18(20-15)21-17(23)13-6-4-11(22(24)25)9-14(13)19/h4-7,9-10H,2-3,8H2,1H3,(H,20,21,23) |
| InChIKey | WGRJYYUJRFEJCV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|