C19H19N3O4S — CID 16850487
N-(5-nitro-1,3-benzothiazol-2-yl)-4-pentoxybenzamide (PubChem CID 16850487) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-(5-nitro-1,3-benzothiazol-2-yl)-4-pentoxybenzamide.
| Compound Name | N-(5-nitro-1,3-benzothiazol-2-yl)-4-pentoxybenzamide |
|---|---|
| PubChem CID | 16850487 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-(5-nitro-1,3-benzothiazol-2-yl)-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)Nc2nc3cc([N+](=O)[O-])ccc3s2)cc1 |
| InChI | InChI=1S/C19H19N3O4S/c1-2-3-4-11-26-15-8-5-13(6-9-15)18(23)21-19-20-16-12-14(22(24)25)7-10-17(16)27-19/h5-10,12H,2-4,11H2,1H3,(H,20,21,23) |
| InChIKey | GAODWFKGWBWNKQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|