C16H11N3O5S — CID 1144073
[4-[(6-nitro-1,3-benzothiazol-2-yl)carbamoyl]phenyl] acetate (PubChem CID 1144073) has the molecular formula C16H11N3O5S and a molecular weight of 357.35 g/mol. Its IUPAC name is [4-[(6-nitro-1,3-benzothiazol-2-yl)carbamoyl]phenyl] acetate.
| Compound Name | [4-[(6-nitro-1,3-benzothiazol-2-yl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 1144073 |
| Molecular Formula | C16H11N3O5S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | [4-[(6-nitro-1,3-benzothiazol-2-yl)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)Nc2nc3ccc([N+](=O)[O-])cc3s2)cc1 |
| InChI | InChI=1S/C16H11N3O5S/c1-9(20)24-12-5-2-10(3-6-12)15(21)18-16-17-13-7-4-11(19(22)23)8-14(13)25-16/h2-8H,1H3,(H,17,18,21) |
| InChIKey | BHIHRLBVNDBCDK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|