C16H11N3O5S — CID 3147213
methyl 4-[(5-nitro-1,3-benzothiazol-2-yl)carbamoyl]benzoate (PubChem CID 3147213) has the molecular formula C16H11N3O5S and a molecular weight of 357.35 g/mol. Its IUPAC name is methyl 4-[(5-nitro-1,3-benzothiazol-2-yl)carbamoyl]benzoate.
| Compound Name | methyl 4-[(5-nitro-1,3-benzothiazol-2-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 3147213 |
| Molecular Formula | C16H11N3O5S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | methyl 4-[(5-nitro-1,3-benzothiazol-2-yl)carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2nc3cc([N+](=O)[O-])ccc3s2)cc1 |
| InChI | InChI=1S/C16H11N3O5S/c1-24-15(21)10-4-2-9(3-5-10)14(20)18-16-17-12-8-11(19(22)23)6-7-13(12)25-16/h2-8H,1H3,(H,17,18,20) |
| InChIKey | WVBKHRYDEQBGSN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|