C15H8F3N3O3S — CID 16850466
N-(5-nitro-1,3-benzothiazol-2-yl)-3-(trifluoromethyl)benzamide (PubChem CID 16850466) has the molecular formula C15H8F3N3O3S and a molecular weight of 367.31 g/mol. Its IUPAC name is N-(5-nitro-1,3-benzothiazol-2-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(5-nitro-1,3-benzothiazol-2-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 16850466 |
| Molecular Formula | C15H8F3N3O3S |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | N-(5-nitro-1,3-benzothiazol-2-yl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1nc2cc([N+](=O)[O-])ccc2s1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H8F3N3O3S/c16-15(17,18)9-3-1-2-8(6-9)13(22)20-14-19-11-7-10(21(23)24)4-5-12(11)25-14/h1-7H,(H,19,20,22) |
| InChIKey | BNCHARLRORLSDL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|