C14H8ClN3O3S — CID 16850432
2-chloro-N-(5-nitro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 16850432) has the molecular formula C14H8ClN3O3S and a molecular weight of 333.76 g/mol. Its IUPAC name is 2-chloro-N-(5-nitro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 2-chloro-N-(5-nitro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 16850432 |
| Molecular Formula | C14H8ClN3O3S |
| Molecular Weight | 333.76 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 2-chloro-N-(5-nitro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc2cc([N+](=O)[O-])ccc2s1)c1ccccc1Cl |
| InChI | InChI=1S/C14H8ClN3O3S/c15-10-4-2-1-3-9(10)13(19)17-14-16-11-7-8(18(20)21)5-6-12(11)22-14/h1-7H,(H,16,17,19) |
| InChIKey | RYAYWIBEQZKDML-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.76 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|