C18H10ClN3O3S — CID 19629690
5-chloro-N-(6-nitro-1,3-benzothiazol-2-yl)naphthalene-1-carboxamide (PubChem CID 19629690) has the molecular formula C18H10ClN3O3S and a molecular weight of 383.82 g/mol. Its IUPAC name is 5-chloro-N-(6-nitro-1,3-benzothiazol-2-yl)naphthalene-1-carboxamide.
| Compound Name | 5-chloro-N-(6-nitro-1,3-benzothiazol-2-yl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 19629690 |
| Molecular Formula | C18H10ClN3O3S |
| Molecular Weight | 383.82 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | 5-chloro-N-(6-nitro-1,3-benzothiazol-2-yl)naphthalene-1-carboxamide |
| SMILES | O=C(Nc1nc2ccc([N+](=O)[O-])cc2s1)c1cccc2c(Cl)cccc12 |
| InChI | InChI=1S/C18H10ClN3O3S/c19-14-6-2-3-11-12(14)4-1-5-13(11)17(23)21-18-20-15-8-7-10(22(24)25)9-16(15)26-18/h1-9H,(H,20,21,23) |
| InChIKey | BWFYTZRILZSFLI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.82 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|