C15H8N3O5S- — CID 7329698
2-[(6-nitro-1,3-benzothiazol-2-yl)carbamoyl]benzoate (PubChem CID 7329698) has the molecular formula C15H8N3O5S- and a molecular weight of 342.31 g/mol. Its IUPAC name is 2-[(6-nitro-1,3-benzothiazol-2-yl)carbamoyl]benzoate.
| Compound Name | 2-[(6-nitro-1,3-benzothiazol-2-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 7329698 |
| Molecular Formula | C15H8N3O5S- |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 2-[(6-nitro-1,3-benzothiazol-2-yl)carbamoyl]benzoate |
| SMILES | O=C([O-])c1ccccc1C(=O)Nc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C15H9N3O5S/c19-13(9-3-1-2-4-10(9)14(20)21)17-15-16-11-6-5-8(18(22)23)7-12(11)24-15/h1-7H,(H,20,21)(H,16,17,19)/p-1 |
| InChIKey | NYQXEQMZAAOQLU-UHFFFAOYSA-M |
| XLogP | 1.82 |
| TPSA | 125.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|