C19H12FN5O3S — CID 57394068
2-(4-fluoroanilino)-N-(6-nitro-1,3-benzothiazol-2-yl)pyridine-3-carboxamide (PubChem CID 57394068) has the molecular formula C19H12FN5O3S and a molecular weight of 409.40 g/mol. Its IUPAC name is 2-(4-fluoroanilino)-N-(6-nitro-1,3-benzothiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 2-(4-fluoroanilino)-N-(6-nitro-1,3-benzothiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 57394068 |
| Molecular Formula | C19H12FN5O3S |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 2-(4-fluoroanilino)-N-(6-nitro-1,3-benzothiazol-2-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1nc2ccc([N+](=O)[O-])cc2s1)c1cccnc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H12FN5O3S/c20-11-3-5-12(6-4-11)22-17-14(2-1-9-21-17)18(26)24-19-23-15-8-7-13(25(27)28)10-16(15)29-19/h1-10H,(H,21,22)(H,23,24,26) |
| InChIKey | OVXXIKQMELSIES-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|