C17H14N4O3S — CID 56575055
N-[4-[(6-nitro-1,3-benzothiazol-2-yl)amino]phenyl]cyclopropanecarboxamide (PubChem CID 56575055) has the molecular formula C17H14N4O3S and a molecular weight of 354.39 g/mol. Its IUPAC name is N-[4-[(6-nitro-1,3-benzothiazol-2-yl)amino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[(6-nitro-1,3-benzothiazol-2-yl)amino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 56575055 |
| Molecular Formula | C17H14N4O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | N-[4-[(6-nitro-1,3-benzothiazol-2-yl)amino]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1ccc(Nc2nc3ccc([N+](=O)[O-])cc3s2)cc1)C1CC1 |
| InChI | InChI=1S/C17H14N4O3S/c22-16(10-1-2-10)18-11-3-5-12(6-4-11)19-17-20-14-8-7-13(21(23)24)9-15(14)25-17/h3-10H,1-2H2,(H,18,22)(H,19,20) |
| InChIKey | IQDLSVVZJDFLHT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|