C18H10F3N5O4S2 — CID 16955308
N-(6-nitro-1,3-benzothiazol-2-yl)-2-[4-(trifluoromethoxy)anilino]-1,3-thiazole-4-carboxamide (PubChem CID 16955308) has the molecular formula C18H10F3N5O4S2 and a molecular weight of 481.44 g/mol. Its IUPAC name is N-(6-nitro-1,3-benzothiazol-2-yl)-2-[4-(trifluoromethoxy)anilino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(6-nitro-1,3-benzothiazol-2-yl)-2-[4-(trifluoromethoxy)anilino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16955308 |
| Molecular Formula | C18H10F3N5O4S2 |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | N-(6-nitro-1,3-benzothiazol-2-yl)-2-[4-(trifluoromethoxy)anilino]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1nc2ccc([N+](=O)[O-])cc2s1)c1csc(Nc2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C18H10F3N5O4S2/c19-18(20,21)30-11-4-1-9(2-5-11)22-16-24-13(8-31-16)15(27)25-17-23-12-6-3-10(26(28)29)7-14(12)32-17/h1-8H,(H,22,24)(H,23,25,27) |
| InChIKey | UJVVJNXHRYSAJV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|