C16H10N6O3S2 — CID 90509854
N-(6-nitro-1,3-benzothiazol-2-yl)-2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxamide (PubChem CID 90509854) has the molecular formula C16H10N6O3S2 and a molecular weight of 398.43 g/mol. Its IUPAC name is N-(6-nitro-1,3-benzothiazol-2-yl)-2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(6-nitro-1,3-benzothiazol-2-yl)-2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90509854 |
| Molecular Formula | C16H10N6O3S2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | N-(6-nitro-1,3-benzothiazol-2-yl)-2-(pyridin-2-ylamino)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1nc2ccc([N+](=O)[O-])cc2s1)c1csc(Nc2ccccn2)n1 |
| InChI | InChI=1S/C16H10N6O3S2/c23-14(11-8-26-15(19-11)20-13-3-1-2-6-17-13)21-16-18-10-5-4-9(22(24)25)7-12(10)27-16/h1-8H,(H,17,19,20)(H,18,21,23) |
| InChIKey | AJSWYGRAADBWPD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 122.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|