C13H11N7O3S2 — CID 57171395
2-[(diaminomethylideneamino)methyl]-N-(6-nitro-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 57171395) has the molecular formula C13H11N7O3S2 and a molecular weight of 377.41 g/mol. Its IUPAC name is 2-[(diaminomethylideneamino)methyl]-N-(6-nitro-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(diaminomethylideneamino)methyl]-N-(6-nitro-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 57171395 |
| Molecular Formula | C13H11N7O3S2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 2-[(diaminomethylideneamino)methyl]-N-(6-nitro-1,3-benzothiazol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | NC(N)=NCc1nc(C(=O)Nc2nc3ccc([N+](=O)[O-])cc3s2)cs1 |
| InChI | InChI=1S/C13H11N7O3S2/c14-12(15)16-4-10-17-8(5-24-10)11(21)19-13-18-7-2-1-6(20(22)23)3-9(7)25-13/h1-3,5H,4H2,(H4,14,15,16)(H,18,19,21) |
| InChIKey | GVYIEOZVRKXDEA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 162.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|