C11H9FN4O3S — CID 66377693
2-(aminomethyl)-N-(2-fluoro-4-nitrophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 66377693) has the molecular formula C11H9FN4O3S and a molecular weight of 296.28 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2-fluoro-4-nitrophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-(2-fluoro-4-nitrophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66377693 |
| Molecular Formula | C11H9FN4O3S |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2-(aminomethyl)-N-(2-fluoro-4-nitrophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | NCc1nc(C(=O)Nc2ccc([N+](=O)[O-])cc2F)cs1 |
| InChI | InChI=1S/C11H9FN4O3S/c12-7-3-6(16(18)19)1-2-8(7)15-11(17)9-5-20-10(4-13)14-9/h1-3,5H,4,13H2,(H,15,17) |
| InChIKey | MLAXULQMKWQORW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|