C11H9ClIN3OS — CID 114259758
2-(aminomethyl)-N-(2-chloro-5-iodophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 114259758) has the molecular formula C11H9ClIN3OS and a molecular weight of 393.64 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2-chloro-5-iodophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-(2-chloro-5-iodophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 114259758 |
| Molecular Formula | C11H9ClIN3OS |
| Molecular Weight | 393.64 g/mol |
| Exact Mass | 392.92 |
| IUPAC Name | 2-(aminomethyl)-N-(2-chloro-5-iodophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | NCc1nc(C(=O)Nc2cc(I)ccc2Cl)cs1 |
| InChI | InChI=1S/C11H9ClIN3OS/c12-7-2-1-6(13)3-8(7)16-11(17)9-5-18-10(4-14)15-9/h1-3,5H,4,14H2,(H,16,17) |
| InChIKey | VLYRYFUYGHXJRH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.64 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|