C11H8F3N3OS — CID 66376335
2-(aminomethyl)-N-(2,3,5-trifluorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 66376335) has the molecular formula C11H8F3N3OS and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2,3,5-trifluorophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-(2,3,5-trifluorophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66376335 |
| Molecular Formula | C11H8F3N3OS |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 2-(aminomethyl)-N-(2,3,5-trifluorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | NCc1nc(C(=O)Nc2cc(F)cc(F)c2F)cs1 |
| InChI | InChI=1S/C11H8F3N3OS/c12-5-1-6(13)10(14)7(2-5)17-11(18)8-4-19-9(3-15)16-8/h1-2,4H,3,15H2,(H,17,18) |
| InChIKey | FHJZFBVTBUYDGF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|