C12H10F3N3OS — CID 66373606
2-(2-aminoethyl)-N-(2,3,4-trifluorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 66373606) has the molecular formula C12H10F3N3OS and a molecular weight of 301.29 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-(2,3,4-trifluorophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2-aminoethyl)-N-(2,3,4-trifluorophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 66373606 |
| Molecular Formula | C12H10F3N3OS |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-(2-aminoethyl)-N-(2,3,4-trifluorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | NCCc1nc(C(=O)Nc2ccc(F)c(F)c2F)cs1 |
| InChI | InChI=1S/C12H10F3N3OS/c13-6-1-2-7(11(15)10(6)14)18-12(19)8-5-20-9(17-8)3-4-16/h1-2,5H,3-4,16H2,(H,18,19) |
| InChIKey | YWFLFQXUPKOMSD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|