C14H7F3N2OS2 — CID 27826298
2-thiophen-2-yl-N-(2,3,4-trifluorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 27826298) has the molecular formula C14H7F3N2OS2 and a molecular weight of 340.35 g/mol. Its IUPAC name is 2-thiophen-2-yl-N-(2,3,4-trifluorophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-thiophen-2-yl-N-(2,3,4-trifluorophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 27826298 |
| Molecular Formula | C14H7F3N2OS2 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 2-thiophen-2-yl-N-(2,3,4-trifluorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C14H7F3N2OS2/c15-7-3-4-8(12(17)11(7)16)18-13(20)9-6-22-14(19-9)10-2-1-5-21-10/h1-6H,(H,18,20) |
| InChIKey | INUZJYYQFRFLMO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|