C15H11ClN4O2S2 — CID 2743958
1-(4-chlorophenyl)-3-[(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)amino]urea (PubChem CID 2743958) has the molecular formula C15H11ClN4O2S2 and a molecular weight of 378.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)amino]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)amino]urea |
|---|---|
| PubChem CID | 2743958 |
| Molecular Formula | C15H11ClN4O2S2 |
| Molecular Weight | 378.87 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(2-thiophen-2-yl-1,3-thiazole-4-carbonyl)amino]urea |
| SMILES | O=C(NNC(=O)c1csc(-c2cccs2)n1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11ClN4O2S2/c16-9-3-5-10(6-4-9)17-15(22)20-19-13(21)11-8-24-14(18-11)12-2-1-7-23-12/h1-8H,(H,19,21)(H2,17,20,22) |
| InChIKey | ISMFNTAFPCBTIR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.87 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|