C20H14N2O2S2 — CID 117094559
N-(4-phenoxyphenyl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 117094559) has the molecular formula C20H14N2O2S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is N-(4-phenoxyphenyl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-phenoxyphenyl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 117094559 |
| Molecular Formula | C20H14N2O2S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | N-(4-phenoxyphenyl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)c1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C20H14N2O2S2/c23-19(17-13-26-20(22-17)18-7-4-12-25-18)21-14-8-10-16(11-9-14)24-15-5-2-1-3-6-15/h1-13H,(H,21,23) |
| InChIKey | SEHJVKPQIHAADO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |