C23H17N3O3S — CID 16914969
2-benzamido-N-(4-phenoxyphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 16914969) has the molecular formula C23H17N3O3S and a molecular weight of 415.47 g/mol. Its IUPAC name is 2-benzamido-N-(4-phenoxyphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-benzamido-N-(4-phenoxyphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16914969 |
| Molecular Formula | C23H17N3O3S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-benzamido-N-(4-phenoxyphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1nc(C(=O)Nc2ccc(Oc3ccccc3)cc2)cs1)c1ccccc1 |
| InChI | InChI=1S/C23H17N3O3S/c27-21(16-7-3-1-4-8-16)26-23-25-20(15-30-23)22(28)24-17-11-13-19(14-12-17)29-18-9-5-2-6-10-18/h1-15H,(H,24,28)(H,25,26,27) |
| InChIKey | RFRKMQVJVHCPAP-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |