C18H16N4O3S — CID 16948201
N-(4-methoxyphenyl)-2-(phenylcarbamoylamino)-1,3-thiazole-4-carboxamide (PubChem CID 16948201) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-(phenylcarbamoylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-2-(phenylcarbamoylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16948201 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-(4-methoxyphenyl)-2-(phenylcarbamoylamino)-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2csc(NC(=O)Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C18H16N4O3S/c1-25-14-9-7-13(8-10-14)19-16(23)15-11-26-18(21-15)22-17(24)20-12-5-3-2-4-6-12/h2-11H,1H3,(H,19,23)(H2,20,21,22,24) |
| InChIKey | XHONWAMYYSUZEP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |