C15H17N3O3S — CID 134297257
tert-butyl N-[4-(phenylcarbamoyl)-1,3-thiazol-2-yl]carbamate (PubChem CID 134297257) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is tert-butyl N-[4-(phenylcarbamoyl)-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-(phenylcarbamoyl)-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 134297257 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | tert-butyl N-[4-(phenylcarbamoyl)-1,3-thiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(C(=O)Nc2ccccc2)cs1 |
| InChI | InChI=1S/C15H17N3O3S/c1-15(2,3)21-14(20)18-13-17-11(9-22-13)12(19)16-10-7-5-4-6-8-10/h4-9H,1-3H3,(H,16,19)(H,17,18,20) |
| InChIKey | UCPGYLJVXSMLBU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |