C12H16N2O3S — CID 88680289
tert-butyl N-[4-[(E)-1-oxobut-2-en-2-yl]-1,3-thiazol-2-yl]carbamate (PubChem CID 88680289) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is tert-butyl N-[4-[(E)-1-oxobut-2-en-2-yl]-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(E)-1-oxobut-2-en-2-yl]-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 88680289 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | tert-butyl N-[4-[(E)-1-oxobut-2-en-2-yl]-1,3-thiazol-2-yl]carbamate |
| SMILES | C/C=C(/C=O)c1csc(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C12H16N2O3S/c1-5-8(6-15)9-7-18-10(13-9)14-11(16)17-12(2,3)4/h5-7H,1-4H3,(H,13,14,16)/b8-5- |
| InChIKey | NZCMXHUQLAKOGZ-YVMONPNESA-N |
| XLogP | 3.09 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|