C9H12N2O4S — CID 88716756
[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl] formate (PubChem CID 88716756) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl] formate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl] formate |
|---|---|
| PubChem CID | 88716756 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl] formate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(OC=O)cs1 |
| InChI | InChI=1S/C9H12N2O4S/c1-9(2,3)15-8(13)11-7-10-6(4-16-7)14-5-12/h4-5H,1-3H3,(H,10,11,13) |
| InChIKey | JCLVTNUQDGOYQA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|