C11H18N2O2S — CID 65142790
tert-butyl N-(4-propan-2-yl-1,3-thiazol-2-yl)carbamate (PubChem CID 65142790) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is tert-butyl N-(4-propan-2-yl-1,3-thiazol-2-yl)carbamate.
| Compound Name | tert-butyl N-(4-propan-2-yl-1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 65142790 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | tert-butyl N-(4-propan-2-yl-1,3-thiazol-2-yl)carbamate |
| SMILES | CC(C)c1csc(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C11H18N2O2S/c1-7(2)8-6-16-9(12-8)13-10(14)15-11(3,4)5/h6-7H,1-5H3,(H,12,13,14) |
| InChIKey | GSXJUAWYBNZXKH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |