C8H12N2O2S — CID 58913263
methyl N-(4-propan-2-yl-1,3-thiazol-2-yl)carbamate (PubChem CID 58913263) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is methyl N-(4-propan-2-yl-1,3-thiazol-2-yl)carbamate.
| Compound Name | methyl N-(4-propan-2-yl-1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 58913263 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | methyl N-(4-propan-2-yl-1,3-thiazol-2-yl)carbamate |
| SMILES | COC(=O)Nc1nc(C(C)C)cs1 |
| InChI | InChI=1S/C8H12N2O2S/c1-5(2)6-4-13-7(9-6)10-8(11)12-3/h4-5H,1-3H3,(H,9,10,11) |
| InChIKey | KVQKGROVADHVIX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |