C8H13N3O2S — CID 64556710
ethyl N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]carbamate (PubChem CID 64556710) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is ethyl N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]carbamate.
| Compound Name | ethyl N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 64556710 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | ethyl N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1nc(C(C)N)cs1 |
| InChI | InChI=1S/C8H13N3O2S/c1-3-13-8(12)11-7-10-6(4-14-7)5(2)9/h4-5H,3,9H2,1-2H3,(H,10,11,12) |
| InChIKey | NYQOYMSJEKQYDS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |