C14H17N3OS — CID 64555861
N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-3,4-dimethylbenzamide (PubChem CID 64555861) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 64555861 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nc(C(C)N)cs2)cc1C |
| InChI | InChI=1S/C14H17N3OS/c1-8-4-5-11(6-9(8)2)13(18)17-14-16-12(7-19-14)10(3)15/h4-7,10H,15H2,1-3H3,(H,16,17,18) |
| InChIKey | DSXNDSGREIZEPU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |