C11H12N4OS — CID 64557648
N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide (PubChem CID 64557648) has the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. Its IUPAC name is N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide.
| Compound Name | N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 64557648 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide |
| SMILES | CC(N)c1csc(NC(=O)c2ccccn2)n1 |
| InChI | InChI=1S/C11H12N4OS/c1-7(12)9-6-17-11(14-9)15-10(16)8-4-2-3-5-13-8/h2-7H,12H2,1H3,(H,14,15,16) |
| InChIKey | LSJRVYPBWSMDDG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |