C13H12F3N3OS — CID 64556257
N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-4-(trifluoromethyl)benzamide (PubChem CID 64556257) has the molecular formula C13H12F3N3OS and a molecular weight of 315.32 g/mol. Its IUPAC name is N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 64556257 |
| Molecular Formula | C13H12F3N3OS |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-[4-(1-aminoethyl)-1,3-thiazol-2-yl]-4-(trifluoromethyl)benzamide |
| SMILES | CC(N)c1csc(NC(=O)c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C13H12F3N3OS/c1-7(17)10-6-21-12(18-10)19-11(20)8-2-4-9(5-3-8)13(14,15)16/h2-7H,17H2,1H3,(H,18,19,20) |
| InChIKey | OTLDYFLKLSSJJG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |