C14H13F3N2OS — CID 46674238
N-(4-propan-2-yl-1,3-thiazol-2-yl)-3-(trifluoromethyl)benzamide (PubChem CID 46674238) has the molecular formula C14H13F3N2OS and a molecular weight of 314.33 g/mol. Its IUPAC name is N-(4-propan-2-yl-1,3-thiazol-2-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(4-propan-2-yl-1,3-thiazol-2-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 46674238 |
| Molecular Formula | C14H13F3N2OS |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | N-(4-propan-2-yl-1,3-thiazol-2-yl)-3-(trifluoromethyl)benzamide |
| SMILES | CC(C)c1csc(NC(=O)c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C14H13F3N2OS/c1-8(2)11-7-21-13(18-11)19-12(20)9-4-3-5-10(6-9)14(15,16)17/h3-8H,1-2H3,(H,18,19,20) |
| InChIKey | KCCLXTYHJIARPN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |