C16H14F3N3O2S — CID 46113897
N-methyl-N-prop-2-enyl-2-[[3-(trifluoromethyl)benzoyl]amino]-1,3-thiazole-4-carboxamide (PubChem CID 46113897) has the molecular formula C16H14F3N3O2S and a molecular weight of 369.37 g/mol. Its IUPAC name is N-methyl-N-prop-2-enyl-2-[[3-(trifluoromethyl)benzoyl]amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-methyl-N-prop-2-enyl-2-[[3-(trifluoromethyl)benzoyl]amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46113897 |
| Molecular Formula | C16H14F3N3O2S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | N-methyl-N-prop-2-enyl-2-[[3-(trifluoromethyl)benzoyl]amino]-1,3-thiazole-4-carboxamide |
| SMILES | C=CCN(C)C(=O)c1csc(NC(=O)c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C16H14F3N3O2S/c1-3-7-22(2)14(24)12-9-25-15(20-12)21-13(23)10-5-4-6-11(8-10)16(17,18)19/h3-6,8-9H,1,7H2,2H3,(H,20,21,23) |
| InChIKey | RTVWLSXJBDQENS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|