C12H6ClF3N2O2S — CID 87544502
2-[[3-(trifluoromethyl)benzoyl]amino]-1,3-thiazole-4-carbonyl chloride (PubChem CID 87544502) has the molecular formula C12H6ClF3N2O2S and a molecular weight of 334.71 g/mol. Its IUPAC name is 2-[[3-(trifluoromethyl)benzoyl]amino]-1,3-thiazole-4-carbonyl chloride.
| Compound Name | 2-[[3-(trifluoromethyl)benzoyl]amino]-1,3-thiazole-4-carbonyl chloride |
|---|---|
| PubChem CID | 87544502 |
| Molecular Formula | C12H6ClF3N2O2S |
| Molecular Weight | 334.71 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 2-[[3-(trifluoromethyl)benzoyl]amino]-1,3-thiazole-4-carbonyl chloride |
| SMILES | O=C(Nc1nc(C(=O)Cl)cs1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H6ClF3N2O2S/c13-9(19)8-5-21-11(17-8)18-10(20)6-2-1-3-7(4-6)12(14,15)16/h1-5H,(H,17,18,20) |
| InChIKey | WKBCCTKXXDIMPM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.71 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|