C20H10BrF3N2O3S — CID 3264457
N-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(trifluoromethyl)benzamide (PubChem CID 3264457) has the molecular formula C20H10BrF3N2O3S and a molecular weight of 495.28 g/mol. Its IUPAC name is N-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3264457 |
| Molecular Formula | C20H10BrF3N2O3S |
| Molecular Weight | 495.28 g/mol |
| Exact Mass | 493.95 |
| IUPAC Name | N-[4-(6-bromo-2-oxochromen-3-yl)-1,3-thiazol-2-yl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1nc(-c2cc3cc(Br)ccc3oc2=O)cs1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H10BrF3N2O3S/c21-13-4-5-16-11(7-13)8-14(18(28)29-16)15-9-30-19(25-15)26-17(27)10-2-1-3-12(6-10)20(22,23)24/h1-9H,(H,25,26,27) |
| InChIKey | CKASFCJXHZYFIL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.28 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|