C15H8BrF3N2O2 — CID 178063578
N-(5-bromo-1,2-benzoxazol-3-yl)-3-(trifluoromethyl)benzamide (PubChem CID 178063578) has the molecular formula C15H8BrF3N2O2 and a molecular weight of 385.14 g/mol. Its IUPAC name is N-(5-bromo-1,2-benzoxazol-3-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(5-bromo-1,2-benzoxazol-3-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 178063578 |
| Molecular Formula | C15H8BrF3N2O2 |
| Molecular Weight | 385.14 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | N-(5-bromo-1,2-benzoxazol-3-yl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1noc2ccc(Br)cc12)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H8BrF3N2O2/c16-10-4-5-12-11(7-10)13(21-23-12)20-14(22)8-2-1-3-9(6-8)15(17,18)19/h1-7H,(H,20,21,22) |
| InChIKey | RWQJWNQXZKCBOV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.14 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |