C16H9F3N4O3 — CID 152673627
N-(6-nitroquinazolin-4-yl)-3-(trifluoromethyl)benzamide (PubChem CID 152673627) has the molecular formula C16H9F3N4O3 and a molecular weight of 362.27 g/mol. Its IUPAC name is N-(6-nitroquinazolin-4-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(6-nitroquinazolin-4-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 152673627 |
| Molecular Formula | C16H9F3N4O3 |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | N-(6-nitroquinazolin-4-yl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ncnc2ccc([N+](=O)[O-])cc12)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H9F3N4O3/c17-16(18,19)10-3-1-2-9(6-10)15(24)22-14-12-7-11(23(25)26)4-5-13(12)20-8-21-14/h1-8H,(H,20,21,22,24) |
| InChIKey | ZMBPGUMQBGWPCL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|