C15H9F3N4O2 — CID 5328200
7-nitro-N-[3-(trifluoromethyl)phenyl]quinazolin-4-amine (PubChem CID 5328200) has the molecular formula C15H9F3N4O2 and a molecular weight of 334.26 g/mol. Its IUPAC name is 7-nitro-N-[3-(trifluoromethyl)phenyl]quinazolin-4-amine.
| Compound Name | 7-nitro-N-[3-(trifluoromethyl)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 5328200 |
| Molecular Formula | C15H9F3N4O2 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 7-nitro-N-[3-(trifluoromethyl)phenyl]quinazolin-4-amine |
| SMILES | O=[N+]([O-])c1ccc2c(Nc3cccc(C(F)(F)F)c3)ncnc2c1 |
| InChI | InChI=1S/C15H9F3N4O2/c16-15(17,18)9-2-1-3-10(6-9)21-14-12-5-4-11(22(23)24)7-13(12)19-8-20-14/h1-8H,(H,19,20,21) |
| InChIKey | VMGLSQQSTMVBST-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|